C26H34F6N8O2 — CID 158206896
1,1,1,4,4,4-hexafluorobutane-2,3-dione;2-(4-propan-2-ylpiperazin-1-yl)-5-[5-(4-propan-2-ylpiperazin-1-yl)pyrazin-2-yl]pyrazine (PubChem CID 158206896) has the molecular formula C26H34F6N8O2 and a molecular weight of 604.60 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;2-(4-propan-2-ylpiperazin-1-yl)-5-[5-(4-propan-2-ylpiperazin-1-yl)pyrazin-2-yl]pyrazine.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;2-(4-propan-2-ylpiperazin-1-yl)-5-[5-(4-propan-2-ylpiperazin-1-yl)pyrazin-2-yl]pyrazine |
|---|---|
| PubChem CID | 158206896 |
| Molecular Formula | C26H34F6N8O2 |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;2-(4-propan-2-ylpiperazin-1-yl)-5-[5-(4-propan-2-ylpiperazin-1-yl)pyrazin-2-yl]pyrazine |
| SMILES | CC(C)N1CCN(c2cnc(-c3cnc(N4CCN(C(C)C)CC4)cn3)cn2)CC1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H34N8.C4F6O2/c1-17(2)27-5-9-29(10-6-27)21-15-23-19(13-25-21)20-14-26-22(16-24-20)30-11-7-28(8-12-30)18(3)4;5-3(6,7)1(11)2(12)4(8,9)10/h13-18H,5-12H2,1-4H3; |
| InChIKey | GBPJIRPZVAPULI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|