C15H19ClO4 — CID 158207576
6-(5-chloro-2-methoxyphenyl)-3,3-dimethyl-6-oxohexanoic acid (PubChem CID 158207576) has the molecular formula C15H19ClO4 and a molecular weight of 298.77 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyphenyl)-3,3-dimethyl-6-oxohexanoic acid.
| Compound Name | 6-(5-chloro-2-methoxyphenyl)-3,3-dimethyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 158207576 |
| Molecular Formula | C15H19ClO4 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 6-(5-chloro-2-methoxyphenyl)-3,3-dimethyl-6-oxohexanoic acid |
| SMILES | COc1ccc(Cl)cc1C(=O)CCC(C)(C)CC(=O)O |
| InChI | InChI=1S/C15H19ClO4/c1-15(2,9-14(18)19)7-6-12(17)11-8-10(16)4-5-13(11)20-3/h4-5,8H,6-7,9H2,1-3H3,(H,18,19) |
| InChIKey | PRGKJCDJRRCCMI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |