About 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one
5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one (PubChem CID 158207587) has the molecular formula C20H27N7O2
and a molecular weight of 397.48 g/mol. Its IUPAC name is 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one.
Molecular Properties
| Compound Name | 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one |
| PubChem CID | 158207587 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one |
| SMILES | NC(=O)c1cnn(C2CCCC2)c1N.O=C1CC=Nc2c1cnn2C1CCCC1 |
| InChI | InChI=1S/C11H13N3O.C9H14N4O/c15-10-5-6-12-11-9(10)7-13-14(11)8-3-1-2-4-8;10-8-7(9(11)14)5-12-13(8)6-3-1-2-4-6/h6-8H,1-5H2;5-6H,1-4,10H2,(H2,11,14) |
| InChIKey | GBRIDGXVQGMARX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one?
The IUPAC name of 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one (CID 158207587) is 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one.
What is the SMILES notation for 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one?
The canonical SMILES for 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one is NC(=O)c1cnn(C2CCCC2)c1N.O=C1CC=Nc2c1cnn2C1CCCC1.
What is the InChIKey of 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one?
The InChIKey is GBRIDGXVQGMARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O.C9H14N4O/c15-10-5-6-12-11-9(10)7-13-14(11)8-3-1-2-4-8;10-8-7(9(11)14)5-12-13(8)6-3-1-2-4-6/h6-8H,1-5H2;5-6H,1-4,10H2,(H2,11,14).
What are the key properties of 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one?
5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one has a molecular weight of 397.48 g/mol, XLogP of 2.97, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-cyclopentylpyrazole-4-carboxamide;1-cyclopentyl-5H-pyrazolo[5,4-b]pyridin-4-one is sourced from PubChem (CID 158207587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).