About 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane
2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane (PubChem CID 158207882) has the molecular formula C6H14N2S6
and a molecular weight of 306.59 g/mol. Its IUPAC name is 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane.
Molecular Properties
| Compound Name | 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane |
| PubChem CID | 158207882 |
| Molecular Formula | C6H14N2S6 |
| Molecular Weight | 306.59 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane |
| SMILES | CSSC.S=C(S)NCCNC(=S)S |
| InChI | InChI=1S/C4H8N2S4.C2H6S2/c7-3(8)5-1-2-6-4(9)10;1-3-4-2/h1-2H2,(H2,5,7,8)(H2,6,9,10);1-2H3 |
| InChIKey | GBSGQIBFFUXWTB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane?
The IUPAC name of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane (CID 158207882) is 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane.
What is the SMILES notation for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane?
The canonical SMILES for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane is CSSC.S=C(S)NCCNC(=S)S.
What is the InChIKey of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane?
The InChIKey is GBSGQIBFFUXWTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2S4.C2H6S2/c7-3(8)5-1-2-6-4(9)10;1-3-4-2/h1-2H2,(H2,5,7,8)(H2,6,9,10);1-2H3.
What are the key properties of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane?
2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane has a molecular weight of 306.59 g/mol, XLogP of 2.22, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;(methyldisulfanyl)methane is sourced from PubChem (CID 158207882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).