C25H17F3N4V — CID 158208179
N-[2-phenyl-6-[2-(trifluoromethyl)phenyl]-4-pyridinyl]-1H-indazol-3-amine;vanadium (PubChem CID 158208179) has the molecular formula C25H17F3N4V and a molecular weight of 481.38 g/mol. Its IUPAC name is N-[2-phenyl-6-[2-(trifluoromethyl)phenyl]-4-pyridinyl]-1H-indazol-3-amine;vanadium.
| Compound Name | N-[2-phenyl-6-[2-(trifluoromethyl)phenyl]-4-pyridinyl]-1H-indazol-3-amine;vanadium |
|---|---|
| PubChem CID | 158208179 |
| Molecular Formula | C25H17F3N4V |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | N-[2-phenyl-6-[2-(trifluoromethyl)phenyl]-4-pyridinyl]-1H-indazol-3-amine;vanadium |
| SMILES | FC(F)(F)c1ccccc1-c1cc(Nc2n[nH]c3ccccc23)cc(-c2ccccc2)n1.[V] |
| InChI | InChI=1S/C25H17F3N4.V/c26-25(27,28)20-12-6-4-10-18(20)23-15-17(14-22(30-23)16-8-2-1-3-9-16)29-24-19-11-5-7-13-21(19)31-32-24;/h1-15H,(H2,29,30,31,32); |
| InChIKey | JFKDGULXKQLOHS-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |