C23H27ClF2O3 — CID 158208485
5-[4-(5-chloro-2,2,6-trimethyl-5,6-dihydro-3H-1-benzofuran-7-yl)-2,6-difluorophenyl]hexanoic acid (PubChem CID 158208485) has the molecular formula C23H27ClF2O3 and a molecular weight of 424.92 g/mol. Its IUPAC name is 5-[4-(5-chloro-2,2,6-trimethyl-5,6-dihydro-3H-1-benzofuran-7-yl)-2,6-difluorophenyl]hexanoic acid.
| Compound Name | 5-[4-(5-chloro-2,2,6-trimethyl-5,6-dihydro-3H-1-benzofuran-7-yl)-2,6-difluorophenyl]hexanoic acid |
|---|---|
| PubChem CID | 158208485 |
| Molecular Formula | C23H27ClF2O3 |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 5-[4-(5-chloro-2,2,6-trimethyl-5,6-dihydro-3H-1-benzofuran-7-yl)-2,6-difluorophenyl]hexanoic acid |
| SMILES | CC(CCCC(=O)O)c1c(F)cc(C2=C3OC(C)(C)CC3=CC(Cl)C2C)cc1F |
| InChI | InChI=1S/C23H27ClF2O3/c1-12(6-5-7-19(27)28)20-17(25)9-14(10-18(20)26)21-13(2)16(24)8-15-11-23(3,4)29-22(15)21/h8-10,12-13,16H,5-7,11H2,1-4H3,(H,27,28) |
| InChIKey | GBTXBAIZPCAPNR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|