C23H15N5S — CID 158208969
4-[5-(1H-imidazol-2-yl)-3-isocyano-4-(naphthalen-2-ylmethyl)thiophen-2-yl]pyridazine (PubChem CID 158208969) has the molecular formula C23H15N5S and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-[5-(1H-imidazol-2-yl)-3-isocyano-4-(naphthalen-2-ylmethyl)thiophen-2-yl]pyridazine.
| Compound Name | 4-[5-(1H-imidazol-2-yl)-3-isocyano-4-(naphthalen-2-ylmethyl)thiophen-2-yl]pyridazine |
|---|---|
| PubChem CID | 158208969 |
| Molecular Formula | C23H15N5S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 4-[5-(1H-imidazol-2-yl)-3-isocyano-4-(naphthalen-2-ylmethyl)thiophen-2-yl]pyridazine |
| SMILES | [C-]#[N+]c1c(-c2ccnnc2)sc(-c2ncc[nH]2)c1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H15N5S/c1-24-20-19(13-15-6-7-16-4-2-3-5-17(16)12-15)22(23-25-10-11-26-23)29-21(20)18-8-9-27-28-14-18/h2-12,14H,13H2,(H,25,26) |
| InChIKey | SFJIHPKWTKZMIX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 58.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|