C37H60O — CID 158209428
1,1-bis(2,6-ditert-butyl-4-ethylphenyl)-2,2-dimethylpropan-1-ol (PubChem CID 158209428) has the molecular formula C37H60O and a molecular weight of 520.89 g/mol. Its IUPAC name is 1,1-bis(2,6-ditert-butyl-4-ethylphenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1,1-bis(2,6-ditert-butyl-4-ethylphenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 158209428 |
| Molecular Formula | C37H60O |
| Molecular Weight | 520.89 g/mol |
| Exact Mass | 520.46 |
| IUPAC Name | 1,1-bis(2,6-ditert-butyl-4-ethylphenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CCc1cc(C(C)(C)C)c(C(O)(c2c(C(C)(C)C)cc(CC)cc2C(C)(C)C)C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C37H60O/c1-18-24-20-26(32(3,4)5)30(27(21-24)33(6,7)8)37(38,36(15,16)17)31-28(34(9,10)11)22-25(19-2)23-29(31)35(12,13)14/h20-23,38H,18-19H2,1-17H3 |
| InChIKey | ZNMBORLOFNNKAG-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.89 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |