C29H26BF6NO2 — CID 158210722
[4-[2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium tetrafluoroborate (PubChem CID 158210722) has the molecular formula C29H26BF6NO2 and a molecular weight of 545.33 g/mol. Its IUPAC name is [4-[2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium tetrafluoroborate.
| Compound Name | [4-[2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium tetrafluoroborate |
|---|---|
| PubChem CID | 158210722 |
| Molecular Formula | C29H26BF6NO2 |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | [4-[2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium tetrafluoroborate |
| SMILES | CC[N+](CC)=C1C=CC(=CC=C2C=C(c3ccc(F)cc3)C=C(c3ccc(F)cc3)O2)C(O)=C1.F[B-](F)(F)F |
| InChI | InChI=1S/C29H25F2NO2.BF4/c1-3-32(4-2)26-15-9-21(28(33)19-26)10-16-27-17-23(20-5-11-24(30)12-6-20)18-29(34-27)22-7-13-25(31)14-8-22;2-1(3,4)5/h5-19H,3-4H2,1-2H3;/q;-1/p+1 |
| InChIKey | GCAUHYNHKQVJEB-UHFFFAOYSA-O |
| XLogP | 8.03 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|