C81H114N12O12S3 — CID 158211677
2-[(6-amino-2-pyridinyl)sulfonyl]-1-[6-tert-butyl-2-[2,2-dimethyl-3-(oxan-4-yl)pyrrolidin-1-yl]-3-pyridinyl]ethanone (PubChem CID 158211677) has the molecular formula C81H114N12O12S3 and a molecular weight of 1544.08 g/mol. Its IUPAC name is 2-[(6-amino-2-pyridinyl)sulfonyl]-1-[6-tert-butyl-2-[2,2-dimethyl-3-(oxan-4-yl)pyrrolidin-1-yl]-3-pyridinyl]ethanone.
| Compound Name | 2-[(6-amino-2-pyridinyl)sulfonyl]-1-[6-tert-butyl-2-[2,2-dimethyl-3-(oxan-4-yl)pyrrolidin-1-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 158211677 |
| Molecular Formula | C81H114N12O12S3 |
| Molecular Weight | 1544.08 g/mol |
| Exact Mass | 1542.78 |
| IUPAC Name | 2-[(6-amino-2-pyridinyl)sulfonyl]-1-[6-tert-butyl-2-[2,2-dimethyl-3-(oxan-4-yl)pyrrolidin-1-yl]-3-pyridinyl]ethanone |
| SMILES | CC(C)(C)c1ccc(C(=O)CS(=O)(=O)c2cccc(N)n2)c(N2CCC(C3CCOCC3)C2(C)C)n1.CC(C)(C)c1ccc(C(=O)CS(=O)(=O)c2cccc(N)n2)c(N2CCC(C3CCOCC3)C2(C)C)n1.CC(C)(C)c1ccc(C(=O)CS(=O)(=O)c2cccc(N)n2)c(N2CCC(C3CCOCC3)C2(C)C)n1 |
| InChI | InChI=1S/3C27H38N4O4S/c3*1-26(2,3)22-10-9-19(21(32)17-36(33,34)24-8-6-7-23(28)30-24)25(29-22)31-14-11-20(27(31,4)5)18-12-15-35-16-13-18/h3*6-10,18,20H,11-17H2,1-5H3,(H2,28,30) |
| InChIKey | GCDQTJVBDVFIEP-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 346.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 108 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1544.08 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 24 |