C18H15F5N6O — CID 158214436
2-[(1R,2S)-2-fluorocyclopropyl]-N-[7-(methylamino)-5-(2,3,5,6-tetrafluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]acetamide (PubChem CID 158214436) has the molecular formula C18H15F5N6O and a molecular weight of 426.35 g/mol. Its IUPAC name is 2-[(1R,2S)-2-fluorocyclopropyl]-N-[7-(methylamino)-5-(2,3,5,6-tetrafluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]acetamide.
| Compound Name | 2-[(1R,2S)-2-fluorocyclopropyl]-N-[7-(methylamino)-5-(2,3,5,6-tetrafluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 158214436 |
| Molecular Formula | C18H15F5N6O |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[(1R,2S)-2-fluorocyclopropyl]-N-[7-(methylamino)-5-(2,3,5,6-tetrafluoroanilino)pyrazolo[1,5-a]pyrimidin-3-yl]acetamide |
| SMILES | CNc1cc(Nc2c(F)c(F)cc(F)c2F)nc2c(NC(=O)C[C@@H]3C[C@@H]3F)cnn12 |
| InChI | InChI=1S/C18H15F5N6O/c1-24-13-5-12(27-17-15(22)9(20)4-10(21)16(17)23)28-18-11(6-25-29(13)18)26-14(30)3-7-2-8(7)19/h4-8,24H,2-3H2,1H3,(H,26,30)(H,27,28)/t7-,8-/m0/s1 |
| InChIKey | GCLWYKMFPSEVKE-YUMQZZPRSA-N |
| XLogP | 3.76 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|