About triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate
triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate (PubChem CID 15821491) has the molecular formula C38H33NO2P2
and a molecular weight of 597.64 g/mol. Its IUPAC name is triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate.
Molecular Properties
| Compound Name | triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate |
| PubChem CID | 15821491 |
| Molecular Formula | C38H33NO2P2 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate |
| SMILES | CC(=O)[O-].c1ccc(P(=N[P+](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30NP2.C2H4O2/c1-7-19-31(20-8-1)38(32-21-9-2-10-22-32,33-23-11-3-12-24-33)37-39(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36;1-2(3)4/h1-30H;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | AAOBUKZEIBZRBI-UHFFFAOYSA-M |
| XLogP | 5.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate?
The IUPAC name of triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate (CID 15821491) is triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate.
What is the SMILES notation for triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate?
The canonical SMILES for triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate is CC(=O)[O-].c1ccc(P(=N[P+](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate?
The InChIKey is AAOBUKZEIBZRBI-UHFFFAOYSA-M. The full InChI is InChI=1S/C36H30NP2.C2H4O2/c1-7-19-31(20-8-1)38(32-21-9-2-10-22-32,33-23-11-3-12-24-33)37-39(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36;1-2(3)4/h1-30H;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate?
triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate has a molecular weight of 597.64 g/mol, XLogP of 5.83, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl-[(triphenyl-λ5-phosphanylidene)amino]phosphanium acetate is sourced from PubChem (CID 15821491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).