C28H25N5O5+2 — CID 158215587
16-[4,5-bis(hydroxymethyl)-2-nitrophenyl]-13,17-diaza-2,24-diazoniahexacyclo[11.11.0.01,17.02,11.04,9.019,24]tetracosa-2,4,6,8,10,19,21,23-octaen-18-one (PubChem CID 158215587) has the molecular formula C28H25N5O5+2 and a molecular weight of 511.54 g/mol. Its IUPAC name is 16-[4,5-bis(hydroxymethyl)-2-nitrophenyl]-13,17-diaza-2,24-diazoniahexacyclo[11.11.0.01,17.02,11.04,9.019,24]tetracosa-2,4,6,8,10,19,21,23-octaen-18-one.
| Compound Name | 16-[4,5-bis(hydroxymethyl)-2-nitrophenyl]-13,17-diaza-2,24-diazoniahexacyclo[11.11.0.01,17.02,11.04,9.019,24]tetracosa-2,4,6,8,10,19,21,23-octaen-18-one |
|---|---|
| PubChem CID | 158215587 |
| Molecular Formula | C28H25N5O5+2 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 16-[4,5-bis(hydroxymethyl)-2-nitrophenyl]-13,17-diaza-2,24-diazoniahexacyclo[11.11.0.01,17.02,11.04,9.019,24]tetracosa-2,4,6,8,10,19,21,23-octaen-18-one |
| SMILES | O=C1c2cccc[n+]2C23N(CCC(c4cc(CO)c(CO)cc4[N+](=O)[O-])N12)Cc1cc2ccccc2c[n+]13 |
| InChI | InChI=1S/C28H25N5O5/c34-16-20-12-23(26(33(37)38)13-21(20)17-35)24-8-10-29-15-22-11-18-5-1-2-6-19(18)14-31(22)28(29)30-9-4-3-7-25(30)27(36)32(24)28/h1-7,9,11-14,24,34-35H,8,10,15-17H2/q+2 |
| InChIKey | KCFQGNMDGPZLOI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|