C39H36F3N5O4 — CID 158216841
5-(1,3-benzoxazol-2-yl)-2-(oxan-4-ylmethyl)aniline;2-[1-(oxan-4-yl)-2-(trifluoromethyl)benzimidazol-5-yl]-1,3-benzoxazole (PubChem CID 158216841) has the molecular formula C39H36F3N5O4 and a molecular weight of 695.74 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-2-yl)-2-(oxan-4-ylmethyl)aniline;2-[1-(oxan-4-yl)-2-(trifluoromethyl)benzimidazol-5-yl]-1,3-benzoxazole.
| Compound Name | 5-(1,3-benzoxazol-2-yl)-2-(oxan-4-ylmethyl)aniline;2-[1-(oxan-4-yl)-2-(trifluoromethyl)benzimidazol-5-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 158216841 |
| Molecular Formula | C39H36F3N5O4 |
| Molecular Weight | 695.74 g/mol |
| Exact Mass | 695.27 |
| IUPAC Name | 5-(1,3-benzoxazol-2-yl)-2-(oxan-4-ylmethyl)aniline;2-[1-(oxan-4-yl)-2-(trifluoromethyl)benzimidazol-5-yl]-1,3-benzoxazole |
| SMILES | FC(F)(F)c1nc2cc(-c3nc4ccccc4o3)ccc2n1C1CCOCC1.Nc1cc(-c2nc3ccccc3o2)ccc1CC1CCOCC1 |
| InChI | InChI=1S/C20H16F3N3O2.C19H20N2O2/c21-20(22,23)19-25-15-11-12(18-24-14-3-1-2-4-17(14)28-18)5-6-16(15)26(19)13-7-9-27-10-8-13;20-16-12-15(19-21-17-3-1-2-4-18(17)23-19)6-5-14(16)11-13-7-9-22-10-8-13/h1-6,11,13H,7-10H2;1-6,12-13H,7-11,20H2 |
| InChIKey | GCTILBWDCALFAE-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 114.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.74 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|