C26H38N2 — CID 158216876
(1S)-N-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-amine;(1R)-N-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 158216876) has the molecular formula C26H38N2 and a molecular weight of 378.60 g/mol. Its IUPAC name is (1S)-N-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-amine;(1R)-N-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S)-N-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-amine;(1R)-N-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 158216876 |
| Molecular Formula | C26H38N2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | (1S)-N-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-amine;(1R)-N-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC(C)N[C@@H]1CCCc2ccccc21.CC(C)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/2C13H19N/c2*1-10(2)14-13-9-5-7-11-6-3-4-8-12(11)13/h2*3-4,6,8,10,13-14H,5,7,9H2,1-2H3/t2*13-/m10/s1 |
| InChIKey | GCTMGZYEQHRZNC-JACLSRQLSA-N |
| XLogP | 6.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |