C28H39BrN2O8S — CID 158217215
3-[4-(2-amino-1,3-thiazol-4-yl)-3,5-dimethylphenoxy]propane-1,2-diol;2-bromo-1-[4-(2,2-dihydroxyethoxy)-2,6-dimethylphenyl]ethanone;ethanol (PubChem CID 158217215) has the molecular formula C28H39BrN2O8S and a molecular weight of 643.60 g/mol. Its IUPAC name is 3-[4-(2-amino-1,3-thiazol-4-yl)-3,5-dimethylphenoxy]propane-1,2-diol;2-bromo-1-[4-(2,2-dihydroxyethoxy)-2,6-dimethylphenyl]ethanone;ethanol.
| Compound Name | 3-[4-(2-amino-1,3-thiazol-4-yl)-3,5-dimethylphenoxy]propane-1,2-diol;2-bromo-1-[4-(2,2-dihydroxyethoxy)-2,6-dimethylphenyl]ethanone;ethanol |
|---|---|
| PubChem CID | 158217215 |
| Molecular Formula | C28H39BrN2O8S |
| Molecular Weight | 643.60 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 3-[4-(2-amino-1,3-thiazol-4-yl)-3,5-dimethylphenoxy]propane-1,2-diol;2-bromo-1-[4-(2,2-dihydroxyethoxy)-2,6-dimethylphenyl]ethanone;ethanol |
| SMILES | CCO.Cc1cc(OCC(O)CO)cc(C)c1-c1csc(N)n1.Cc1cc(OCC(O)O)cc(C)c1C(=O)CBr |
| InChI | InChI=1S/C14H18N2O3S.C12H15BrO4.C2H6O/c1-8-3-11(19-6-10(18)5-17)4-9(2)13(8)12-7-20-14(15)16-12;1-7-3-9(17-6-11(15)16)4-8(2)12(7)10(14)5-13;1-2-3/h3-4,7,10,17-18H,5-6H2,1-2H3,(H2,15,16);3-4,11,15-16H,5-6H2,1-2H3;3H,2H2,1H3 |
| InChIKey | GCUODHMRTRWDJM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 175.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|