About 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile
4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile (PubChem CID 158218552) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile |
| PubChem CID | 158218552 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile |
| SMILES | CC(C)(C)C#CCO.CC(C)(C)C#N |
| InChI | InChI=1S/C7H12O.C5H9N/c1-7(2,3)5-4-6-8;1-5(2,3)4-6/h8H,6H2,1-3H3;1-3H3 |
| InChIKey | GCYRMRNAJPOUGX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile?
The IUPAC name of 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile (CID 158218552) is 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile.
What is the SMILES notation for 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile?
The canonical SMILES for 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile is CC(C)(C)C#CCO.CC(C)(C)C#N.
What is the InChIKey of 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile?
The InChIKey is GCYRMRNAJPOUGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C5H9N/c1-7(2,3)5-4-6-8;1-5(2,3)4-6/h8H,6H2,1-3H3;1-3H3.
What are the key properties of 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile?
4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile has a molecular weight of 195.31 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethylpent-2-yn-1-ol;2,2-dimethylpropanenitrile is sourced from PubChem (CID 158218552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).