C32H36ClN5O6 — CID 158218953
2-[bis[(4-methoxyphenyl)methyl]amino]-N-methoxy-N-methylpyridine-4-carboxamide;2-chloro-N-methoxy-N-methylpyridine-4-carboxamide (PubChem CID 158218953) has the molecular formula C32H36ClN5O6 and a molecular weight of 622.12 g/mol. Its IUPAC name is 2-[bis[(4-methoxyphenyl)methyl]amino]-N-methoxy-N-methylpyridine-4-carboxamide;2-chloro-N-methoxy-N-methylpyridine-4-carboxamide.
| Compound Name | 2-[bis[(4-methoxyphenyl)methyl]amino]-N-methoxy-N-methylpyridine-4-carboxamide;2-chloro-N-methoxy-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 158218953 |
| Molecular Formula | C32H36ClN5O6 |
| Molecular Weight | 622.12 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | 2-[bis[(4-methoxyphenyl)methyl]amino]-N-methoxy-N-methylpyridine-4-carboxamide;2-chloro-N-methoxy-N-methylpyridine-4-carboxamide |
| SMILES | CON(C)C(=O)c1ccnc(Cl)c1.COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(C(=O)N(C)OC)ccn2)cc1 |
| InChI | InChI=1S/C24H27N3O4.C8H9ClN2O2/c1-26(31-4)24(28)20-13-14-25-23(15-20)27(16-18-5-9-21(29-2)10-6-18)17-19-7-11-22(30-3)12-8-19;1-11(13-2)8(12)6-3-4-10-7(9)5-6/h5-15H,16-17H2,1-4H3;3-5H,1-2H3 |
| InChIKey | GCZXDMSIUIQBDT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.12 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|