C38H42BBrCl2N2O11 — CID 158220716
(2R,4R)-5-(2-chloro-4-phenylphenyl)-2-hydroxy-4-(oxaloamino)pentanoic acid;ethyl (2R,4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxypentanoate;phenylboronic acid (PubChem CID 158220716) has the molecular formula C38H42BBrCl2N2O11 and a molecular weight of 864.38 g/mol. Its IUPAC name is (2R,4R)-5-(2-chloro-4-phenylphenyl)-2-hydroxy-4-(oxaloamino)pentanoic acid;ethyl (2R,4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxypentanoate;phenylboronic acid.
| Compound Name | (2R,4R)-5-(2-chloro-4-phenylphenyl)-2-hydroxy-4-(oxaloamino)pentanoic acid;ethyl (2R,4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxypentanoate;phenylboronic acid |
|---|---|
| PubChem CID | 158220716 |
| Molecular Formula | C38H42BBrCl2N2O11 |
| Molecular Weight | 864.38 g/mol |
| Exact Mass | 862.14 |
| IUPAC Name | (2R,4R)-5-(2-chloro-4-phenylphenyl)-2-hydroxy-4-(oxaloamino)pentanoic acid;ethyl (2R,4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxypentanoate;phenylboronic acid |
| SMILES | CCOC(=O)[C@H](O)C[C@H](N)Cc1ccc(Br)cc1Cl.O=C(O)C(=O)N[C@H](Cc1ccc(-c2ccccc2)cc1Cl)C[C@@H](O)C(=O)O.OB(O)c1ccccc1 |
| InChI | InChI=1S/C19H18ClNO6.C13H17BrClNO3.C6H7BO2/c20-15-9-12(11-4-2-1-3-5-11)6-7-13(15)8-14(10-16(22)18(24)25)21-17(23)19(26)27;1-2-19-13(18)12(17)7-10(16)5-8-3-4-9(14)6-11(8)15;8-7(9)6-4-2-1-3-5-6/h1-7,9,14,16,22H,8,10H2,(H,21,23)(H,24,25)(H,26,27);3-4,6,10,12,17H,2,5,7,16H2,1H3;1-5,8-9H/t14-,16-;10-,12-;/m11./s1 |
| InChIKey | GDFBQLAIJOCKHI-KESYDGRDSA-N |
| XLogP | 3.61 |
| TPSA | 236.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|