C30H45Cl2N2P — CID 158221356
dicyclohexyl-[4,4-dichloro-2-[1-(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]cyclohexyl]phosphane (PubChem CID 158221356) has the molecular formula C30H45Cl2N2P and a molecular weight of 535.58 g/mol. Its IUPAC name is dicyclohexyl-[4,4-dichloro-2-[1-(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]cyclohexyl]phosphane.
| Compound Name | dicyclohexyl-[4,4-dichloro-2-[1-(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]cyclohexyl]phosphane |
|---|---|
| PubChem CID | 158221356 |
| Molecular Formula | C30H45Cl2N2P |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | dicyclohexyl-[4,4-dichloro-2-[1-(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]cyclohexyl]phosphane |
| SMILES | Cc1cc(C)c(N2CCNC2=C2CC(Cl)(Cl)CCC2P(C2CCCCC2)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C30H45Cl2N2P/c1-21-18-22(2)28(23(3)19-21)34-17-16-33-29(34)26-20-30(31,32)15-14-27(26)35(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h18-19,24-25,27,33H,4-17,20H2,1-3H3 |
| InChIKey | JGTCITMOURRDSU-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|