C41H94O6Si7 — CID 158221397
4-[3-[[dipropyl(3-tripropylsilyloxysilylpropyl)silyl]oxymethyl-dipropylsilyl]oxysilylpropyl-dipropylsilyl]oxysilylbutyl prop-2-enoate (PubChem CID 158221397) has the molecular formula C41H94O6Si7 and a molecular weight of 879.80 g/mol. Its IUPAC name is 4-[3-[[dipropyl(3-tripropylsilyloxysilylpropyl)silyl]oxymethyl-dipropylsilyl]oxysilylpropyl-dipropylsilyl]oxysilylbutyl prop-2-enoate.
| Compound Name | 4-[3-[[dipropyl(3-tripropylsilyloxysilylpropyl)silyl]oxymethyl-dipropylsilyl]oxysilylpropyl-dipropylsilyl]oxysilylbutyl prop-2-enoate |
|---|---|
| PubChem CID | 158221397 |
| Molecular Formula | C41H94O6Si7 |
| Molecular Weight | 879.80 g/mol |
| Exact Mass | 878.54 |
| IUPAC Name | 4-[3-[[dipropyl(3-tripropylsilyloxysilylpropyl)silyl]oxymethyl-dipropylsilyl]oxysilylpropyl-dipropylsilyl]oxysilylbutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC[SiH2]O[Si](CCC)(CCC)CCC[SiH2]O[Si](CCC)(CCC)CO[Si](CCC)(CCC)CCC[SiH2]O[Si](CCC)(CCC)CCC |
| InChI | InChI=1S/C41H94O6Si7/c1-11-29-51(30-12-2,38-23-27-49-45-52(31-13-3,32-14-4)33-15-5)44-40-54(36-18-8,37-19-9)47-50-28-24-39-53(34-16-6,35-17-7)46-48-26-22-21-25-43-41(42)20-10/h20H,10-19,21-40,48-50H2,1-9H3 |
| InChIKey | BCRWFIWMLPQGFT-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.80 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|