About N-cyclohexa-2,4-dien-1-yl-N-methylaniline
N-cyclohexa-2,4-dien-1-yl-N-methylaniline (PubChem CID 15822281) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-N-methylaniline.
Molecular Properties
| Compound Name | N-cyclohexa-2,4-dien-1-yl-N-methylaniline |
| PubChem CID | 15822281 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-N-methylaniline |
| SMILES | CN(c1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C13H15N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-10,13H,11H2,1H3 |
| InChIKey | GHZZLRNVTFFHQQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexa-2,4-dien-1-yl-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-2,4-dien-1-yl-N-methylaniline?
The IUPAC name of N-cyclohexa-2,4-dien-1-yl-N-methylaniline (CID 15822281) is N-cyclohexa-2,4-dien-1-yl-N-methylaniline.
What is the SMILES notation for N-cyclohexa-2,4-dien-1-yl-N-methylaniline?
The canonical SMILES for N-cyclohexa-2,4-dien-1-yl-N-methylaniline is CN(c1ccccc1)C1C=CC=CC1.
What is the InChIKey of N-cyclohexa-2,4-dien-1-yl-N-methylaniline?
The InChIKey is GHZZLRNVTFFHQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-10,13H,11H2,1H3.
What are the key properties of N-cyclohexa-2,4-dien-1-yl-N-methylaniline?
N-cyclohexa-2,4-dien-1-yl-N-methylaniline has a molecular weight of 185.27 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-2,4-dien-1-yl-N-methylaniline is sourced from PubChem (CID 15822281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).