C18H17ClF2O4S — CID 158222913
2-fluoro-4-[4-(4-fluorophenoxy)-4-methylpentanoyl]benzenesulfonyl chloride (PubChem CID 158222913) has the molecular formula C18H17ClF2O4S and a molecular weight of 402.85 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-fluorophenoxy)-4-methylpentanoyl]benzenesulfonyl chloride.
| Compound Name | 2-fluoro-4-[4-(4-fluorophenoxy)-4-methylpentanoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 158222913 |
| Molecular Formula | C18H17ClF2O4S |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-fluoro-4-[4-(4-fluorophenoxy)-4-methylpentanoyl]benzenesulfonyl chloride |
| SMILES | CC(C)(CCC(=O)c1ccc(S(=O)(=O)Cl)c(F)c1)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17ClF2O4S/c1-18(2,25-14-6-4-13(20)5-7-14)10-9-16(22)12-3-8-17(15(21)11-12)26(19,23)24/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | GDLOEAONUMYKOR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |