About 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride
2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride (PubChem CID 158225222) has the molecular formula C11H13ClN2O3S
and a molecular weight of 288.76 g/mol. Its IUPAC name is 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride |
| PubChem CID | 158225222 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride |
| SMILES | Cl.NC1CC(=O)N(CC(=O)O)c2ccccc2S1 |
| InChI | InChI=1S/C11H12N2O3S.ClH/c12-9-5-10(14)13(6-11(15)16)7-3-1-2-4-8(7)17-9;/h1-4,9H,5-6,12H2,(H,15,16);1H |
| InChIKey | GDSFHSFMMMHESS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride?
The IUPAC name of 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride (CID 158225222) is 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride.
What is the SMILES notation for 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride?
The canonical SMILES for 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride is Cl.NC1CC(=O)N(CC(=O)O)c2ccccc2S1.
What is the InChIKey of 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride?
The InChIKey is GDSFHSFMMMHESS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S.ClH/c12-9-5-10(14)13(6-11(15)16)7-3-1-2-4-8(7)17-9;/h1-4,9H,5-6,12H2,(H,15,16);1H.
What are the key properties of 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride?
2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride has a molecular weight of 288.76 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl)acetic acid;hydrochloride is sourced from PubChem (CID 158225222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).