C39H42ClN3O5 — CID 158227469
2-(5-amino-2-adamantyl)isoindole-1,3-dione;2-[5-(3-chloro-2-oxopropyl)-2-adamantyl]isoindole-1,3-dione (PubChem CID 158227469) has the molecular formula C39H42ClN3O5 and a molecular weight of 668.23 g/mol. Its IUPAC name is 2-(5-amino-2-adamantyl)isoindole-1,3-dione;2-[5-(3-chloro-2-oxopropyl)-2-adamantyl]isoindole-1,3-dione.
| Compound Name | 2-(5-amino-2-adamantyl)isoindole-1,3-dione;2-[5-(3-chloro-2-oxopropyl)-2-adamantyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158227469 |
| Molecular Formula | C39H42ClN3O5 |
| Molecular Weight | 668.23 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | 2-(5-amino-2-adamantyl)isoindole-1,3-dione;2-[5-(3-chloro-2-oxopropyl)-2-adamantyl]isoindole-1,3-dione |
| SMILES | NC12CC3CC(C1)C(N1C(=O)c4ccccc4C1=O)C(C3)C2.O=C(CCl)CC12CC3CC(C1)C(N1C(=O)c4ccccc4C1=O)C(C3)C2 |
| InChI | InChI=1S/C21H22ClNO3.C18H20N2O2/c22-11-15(24)10-21-7-12-5-13(8-21)18(14(6-12)9-21)23-19(25)16-3-1-2-4-17(16)20(23)26;19-18-7-10-5-11(8-18)15(12(6-10)9-18)20-16(21)13-3-1-2-4-14(13)17(20)22/h1-4,12-14,18H,5-11H2;1-4,10-12,15H,5-9,19H2 |
| InChIKey | GDYWYRIVYMYLMQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.23 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|