C22H16ClF9N4O2 — CID 158228777
1-[2-chloro-5-[1-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]-2-cyclopropylethanone (PubChem CID 158228777) has the molecular formula C22H16ClF9N4O2 and a molecular weight of 574.83 g/mol. Its IUPAC name is 1-[2-chloro-5-[1-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]-2-cyclopropylethanone.
| Compound Name | 1-[2-chloro-5-[1-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 158228777 |
| Molecular Formula | C22H16ClF9N4O2 |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 1-[2-chloro-5-[1-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]-2-cyclopropylethanone |
| SMILES | Cn1nc(OC(F)(F)C(F)C(F)(F)F)c(C(F)(F)F)c1-n1cc(-c2ccc(Cl)c(C(=O)CC3CC3)c2)cn1 |
| InChI | InChI=1S/C22H16ClF9N4O2/c1-35-18(16(20(25,26)27)17(34-35)38-22(31,32)19(24)21(28,29)30)36-9-12(8-33-36)11-4-5-14(23)13(7-11)15(37)6-10-2-3-10/h4-5,7-10,19H,2-3,6H2,1H3 |
| InChIKey | GECWWULIIBGEHL-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |