C9H10F2N2O2 — CID 158229210
(3S)-3-(3,5-difluorophenyl)-N',3-dihydroxypropanimidamide (PubChem CID 158229210) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is (3S)-3-(3,5-difluorophenyl)-N',3-dihydroxypropanimidamide.
| Compound Name | (3S)-3-(3,5-difluorophenyl)-N',3-dihydroxypropanimidamide |
|---|---|
| PubChem CID | 158229210 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | (3S)-3-(3,5-difluorophenyl)-N',3-dihydroxypropanimidamide |
| SMILES | NC(C[C@H](O)c1cc(F)cc(F)c1)=NO |
| InChI | InChI=1S/C9H10F2N2O2/c10-6-1-5(2-7(11)3-6)8(14)4-9(12)13-15/h1-3,8,14-15H,4H2,(H2,12,13)/t8-/m0/s1 |
| InChIKey | GEECUTCHALYMRM-QMMMGPOBSA-N |
| XLogP | 1.13 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|