C22H28N4 — CID 158229879
1,5,13,18,18,19,19-heptamethyl-3,5,8,11-tetrazapentacyclo[9.8.0.02,9.04,8.012,17]nonadeca-2(9),3,6,12,14,16-hexaene (PubChem CID 158229879) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1,5,13,18,18,19,19-heptamethyl-3,5,8,11-tetrazapentacyclo[9.8.0.02,9.04,8.012,17]nonadeca-2(9),3,6,12,14,16-hexaene.
| Compound Name | 1,5,13,18,18,19,19-heptamethyl-3,5,8,11-tetrazapentacyclo[9.8.0.02,9.04,8.012,17]nonadeca-2(9),3,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 158229879 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1,5,13,18,18,19,19-heptamethyl-3,5,8,11-tetrazapentacyclo[9.8.0.02,9.04,8.012,17]nonadeca-2(9),3,6,12,14,16-hexaene |
| SMILES | Cc1cccc2c1N1Cc3c(nc4n(C)ccn34)C1(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C22H28N4/c1-14-9-8-10-15-17(14)26-13-16-18(23-19-24(7)11-12-25(16)19)22(26,6)21(4,5)20(15,2)3/h8-12H,13H2,1-7H3 |
| InChIKey | KTNKBYGKKFDKKN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |