C14H23N5 — CID 158233694
N,N,2-trimethyl-6-[2-(2-methylcyclopenta-1,4-dien-1-yl)ethylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 158233694) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N,N,2-trimethyl-6-[2-(2-methylcyclopenta-1,4-dien-1-yl)ethylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | N,N,2-trimethyl-6-[2-(2-methylcyclopenta-1,4-dien-1-yl)ethylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 158233694 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N,N,2-trimethyl-6-[2-(2-methylcyclopenta-1,4-dien-1-yl)ethylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CC1=C(CC/N=C2/NC(N(C)C)=NC(C)N2)C=CC1 |
| InChI | InChI=1S/C14H23N5/c1-10-6-5-7-12(10)8-9-15-13-16-11(2)17-14(18-13)19(3)4/h5,7,11H,6,8-9H2,1-4H3,(H2,15,16,17,18) |
| InChIKey | QGBASWFJRAHYSJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|