C10H22N6O4 — CID 158234542
1,3,5-triazine-2,4,6-triamine;4,4,4-trimethoxybutan-1-ol (PubChem CID 158234542) has the molecular formula C10H22N6O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1,3,5-triazine-2,4,6-triamine;4,4,4-trimethoxybutan-1-ol.
| Compound Name | 1,3,5-triazine-2,4,6-triamine;4,4,4-trimethoxybutan-1-ol |
|---|---|
| PubChem CID | 158234542 |
| Molecular Formula | C10H22N6O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1,3,5-triazine-2,4,6-triamine;4,4,4-trimethoxybutan-1-ol |
| SMILES | COC(CCCO)(OC)OC.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H16O4.C3H6N6/c1-9-7(10-2,11-3)5-4-6-8;4-1-7-2(5)9-3(6)8-1/h8H,4-6H2,1-3H3;(H6,4,5,6,7,8,9) |
| InChIKey | GEULZZOMPMIBDU-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 164.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|