C46H50N10O4 — CID 158234565
1-[2-[[2-[(2-methoxy-5-methyl-4-pyridinyl)amino]-5-methylpyrimidin-4-yl]amino]-5-methylphenyl]but-3-en-2-one (PubChem CID 158234565) has the molecular formula C46H50N10O4 and a molecular weight of 806.97 g/mol. Its IUPAC name is 1-[2-[[2-[(2-methoxy-5-methyl-4-pyridinyl)amino]-5-methylpyrimidin-4-yl]amino]-5-methylphenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[2-[(2-methoxy-5-methyl-4-pyridinyl)amino]-5-methylpyrimidin-4-yl]amino]-5-methylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158234565 |
| Molecular Formula | C46H50N10O4 |
| Molecular Weight | 806.97 g/mol |
| Exact Mass | 806.40 |
| IUPAC Name | 1-[2-[[2-[(2-methoxy-5-methyl-4-pyridinyl)amino]-5-methylpyrimidin-4-yl]amino]-5-methylphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(C)ccc1Nc1nc(Nc2cc(OC)ncc2C)ncc1C.C=CC(=O)Cc1cc(C)ccc1Nc1nc(Nc2cc(OC)ncc2C)ncc1C |
| InChI | InChI=1S/2C23H25N5O2/c2*1-6-18(29)10-17-9-14(2)7-8-19(17)26-22-16(4)13-25-23(28-22)27-20-11-21(30-5)24-12-15(20)3/h2*6-9,11-13H,1,10H2,2-5H3,(H2,24,25,26,27,28) |
| InChIKey | GEUNEJQBCDTVDY-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 178.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.97 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|