C34H30N10O9 — CID 158234664
4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)-4-(1H-pyrazol-4-ylmethylamino)isoindole-1,3-dione;1H-pyrazole-4-carbaldehyde (PubChem CID 158234664) has the molecular formula C34H30N10O9 and a molecular weight of 722.68 g/mol. Its IUPAC name is 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)-4-(1H-pyrazol-4-ylmethylamino)isoindole-1,3-dione;1H-pyrazole-4-carbaldehyde.
| Compound Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)-4-(1H-pyrazol-4-ylmethylamino)isoindole-1,3-dione;1H-pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 158234664 |
| Molecular Formula | C34H30N10O9 |
| Molecular Weight | 722.68 g/mol |
| Exact Mass | 722.22 |
| IUPAC Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2-(2,6-dioxopiperidin-3-yl)-4-(1H-pyrazol-4-ylmethylamino)isoindole-1,3-dione;1H-pyrazole-4-carbaldehyde |
| SMILES | Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.O=C1CCC(N2C(=O)c3cccc(NCc4cn[nH]c4)c3C2=O)C(=O)N1.O=Cc1cn[nH]c1 |
| InChI | InChI=1S/C17H15N5O4.C13H11N3O4.C4H4N2O/c23-13-5-4-12(15(24)21-13)22-16(25)10-2-1-3-11(14(10)17(22)26)18-6-9-7-19-20-8-9;14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18;7-3-4-1-5-6-2-4/h1-3,7-8,12,18H,4-6H2,(H,19,20)(H,21,23,24);1-3,8H,4-5,14H2,(H,15,17,18);1-3H,(H,5,6) |
| InChIKey | GEUVFANQFQBMRQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 279.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.68 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|