C29H26ClFN2O2 — CID 158236548
N-[(2S)-1-(4-chlorophenyl)-3-oxo-7-pyridin-3-ylheptan-2-yl]-6-fluoronaphthalene-2-carboxamide (PubChem CID 158236548) has the molecular formula C29H26ClFN2O2 and a molecular weight of 488.99 g/mol. Its IUPAC name is N-[(2S)-1-(4-chlorophenyl)-3-oxo-7-pyridin-3-ylheptan-2-yl]-6-fluoronaphthalene-2-carboxamide.
| Compound Name | N-[(2S)-1-(4-chlorophenyl)-3-oxo-7-pyridin-3-ylheptan-2-yl]-6-fluoronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 158236548 |
| Molecular Formula | C29H26ClFN2O2 |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[(2S)-1-(4-chlorophenyl)-3-oxo-7-pyridin-3-ylheptan-2-yl]-6-fluoronaphthalene-2-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccc(Cl)cc1)C(=O)CCCCc1cccnc1)c1ccc2cc(F)ccc2c1 |
| InChI | InChI=1S/C29H26ClFN2O2/c30-25-12-7-20(8-13-25)16-27(28(34)6-2-1-4-21-5-3-15-32-19-21)33-29(35)24-10-9-23-18-26(31)14-11-22(23)17-24/h3,5,7-15,17-19,27H,1-2,4,6,16H2,(H,33,35)/t27-/m0/s1 |
| InChIKey | GFAMIALCWWKRRY-MHZLTWQESA-N |
| XLogP | 6.35 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|