C27H34FN5O6 — CID 158237573
1-[4-(4-amino-2-fluorophenoxy)-2-pyridinyl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;(1-methylpiperidin-4-yl)urea (PubChem CID 158237573) has the molecular formula C27H34FN5O6 and a molecular weight of 543.60 g/mol. Its IUPAC name is 1-[4-(4-amino-2-fluorophenoxy)-2-pyridinyl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;(1-methylpiperidin-4-yl)urea.
| Compound Name | 1-[4-(4-amino-2-fluorophenoxy)-2-pyridinyl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 158237573 |
| Molecular Formula | C27H34FN5O6 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-[4-(4-amino-2-fluorophenoxy)-2-pyridinyl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;(1-methylpiperidin-4-yl)urea |
| SMILES | CC1(C(=O)O)C=CCC(C(=O)O)(c2cc(Oc3ccc(N)cc3F)ccn2)C1.CN1CCC(NC(N)=O)CC1 |
| InChI | InChI=1S/C20H19FN2O5.C7H15N3O/c1-19(17(24)25)6-2-7-20(11-19,18(26)27)16-10-13(5-8-23-16)28-15-4-3-12(22)9-14(15)21;1-10-4-2-6(3-5-10)9-7(8)11/h2-6,8-10H,7,11,22H2,1H3,(H,24,25)(H,26,27);6H,2-5H2,1H3,(H3,8,9,11) |
| InChIKey | GFDPRXCDKMZUCL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 181.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|