C47H44F6O5S3 — CID 158239943
[6-acetyloxy-3-[2-[2,5-bis(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-(4-tert-butylphenyl)-1-benzofuran-5-yl] acetate (PubChem CID 158239943) has the molecular formula C47H44F6O5S3 and a molecular weight of 899.05 g/mol. Its IUPAC name is [6-acetyloxy-3-[2-[2,5-bis(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-(4-tert-butylphenyl)-1-benzofuran-5-yl] acetate.
| Compound Name | [6-acetyloxy-3-[2-[2,5-bis(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-(4-tert-butylphenyl)-1-benzofuran-5-yl] acetate |
|---|---|
| PubChem CID | 158239943 |
| Molecular Formula | C47H44F6O5S3 |
| Molecular Weight | 899.05 g/mol |
| Exact Mass | 898.23 |
| IUPAC Name | [6-acetyloxy-3-[2-[2,5-bis(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-(4-tert-butylphenyl)-1-benzofuran-5-yl] acetate |
| SMILES | CC(=O)Oc1cc2oc(-c3ccc(C(C)(C)C)cc3)c(C3=C(c4cc(-c5ccc(C(C)(C)C)s5)sc4-c4ccc(C(C)(C)C)s4)C(F)(F)C(F)(F)C3(F)F)c2cc1OC(C)=O |
| InChI | InChI=1S/C47H44F6O5S3/c1-23(54)56-30-20-27-29(22-31(30)57-24(2)55)58-40(25-12-14-26(15-13-25)42(3,4)5)37(27)39-38(45(48,49)47(52,53)46(39,50)51)28-21-34(32-16-18-35(59-32)43(6,7)8)61-41(28)33-17-19-36(60-33)44(9,10)11/h12-22H,1-11H3 |
| InChIKey | GFKPFOOHRLKECB-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.05 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|