About 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one
4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one (PubChem CID 15824) has the molecular formula C5H10N2O5
and a molecular weight of 178.14 g/mol. Its IUPAC name is 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one |
| PubChem CID | 15824 |
| Molecular Formula | C5H10N2O5 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one |
| SMILES | O=C1N(CO)C(O)C(O)N1CO |
| InChI | InChI=1S/C5H10N2O5/c8-1-6-3(10)4(11)7(2-9)5(6)12/h3-4,8-11H,1-2H2 |
| InChIKey | ZEYUSQVGRCPBPG-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one?
The IUPAC name of 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one (CID 15824) is 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one.
What is the SMILES notation for 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one?
The canonical SMILES for 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one is O=C1N(CO)C(O)C(O)N1CO.
What is the InChIKey of 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one?
The InChIKey is ZEYUSQVGRCPBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O5/c8-1-6-3(10)4(11)7(2-9)5(6)12/h3-4,8-11H,1-2H2.
What are the key properties of 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one?
4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one has a molecular weight of 178.14 g/mol, XLogP of -2.74, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-1,3-bis(hydroxymethyl)imidazolidin-2-one is sourced from PubChem (CID 15824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).