About 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine
4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine (PubChem CID 158240210) has the molecular formula C22H45NO
and a molecular weight of 339.61 g/mol. Its IUPAC name is 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine.
Molecular Properties
| Compound Name | 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine |
| PubChem CID | 158240210 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine |
| SMILES | CC(C)C1(C(C)C)CCNCC1.CC(C)C1(C(C)C)CCOCC1 |
| InChI | InChI=1S/C11H23N.C11H22O/c2*1-9(2)11(10(3)4)5-7-12-8-6-11/h9-10,12H,5-8H2,1-4H3;9-10H,5-8H2,1-4H3 |
| InChIKey | GFLJSTIDHBHLSJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine?
The IUPAC name of 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine (CID 158240210) is 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine.
What is the SMILES notation for 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine?
The canonical SMILES for 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine is CC(C)C1(C(C)C)CCNCC1.CC(C)C1(C(C)C)CCOCC1.
What is the InChIKey of 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine?
The InChIKey is GFLJSTIDHBHLSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N.C11H22O/c2*1-9(2)11(10(3)4)5-7-12-8-6-11/h9-10,12H,5-8H2,1-4H3;9-10H,5-8H2,1-4H3.
What are the key properties of 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine?
4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine has a molecular weight of 339.61 g/mol, XLogP of 5.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-di(propan-2-yl)oxane;4,4-di(propan-2-yl)piperidine is sourced from PubChem (CID 158240210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).