C18H33N3 — CID 158240440
1,6-bis(2-methylbutan-2-yl)-4,5,6,7,8,9-hexahydrocycloocta[d]triazole (PubChem CID 158240440) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 1,6-bis(2-methylbutan-2-yl)-4,5,6,7,8,9-hexahydrocycloocta[d]triazole.
| Compound Name | 1,6-bis(2-methylbutan-2-yl)-4,5,6,7,8,9-hexahydrocycloocta[d]triazole |
|---|---|
| PubChem CID | 158240440 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 1,6-bis(2-methylbutan-2-yl)-4,5,6,7,8,9-hexahydrocycloocta[d]triazole |
| SMILES | CCC(C)(C)C1CCCc2c(nnn2C(C)(C)CC)CC1 |
| InChI | InChI=1S/C18H33N3/c1-7-17(3,4)14-10-9-11-16-15(13-12-14)19-20-21(16)18(5,6)8-2/h14H,7-13H2,1-6H3 |
| InChIKey | XYTQGEJZIUTCOG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |