About 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol
7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol (PubChem CID 158241376) has the molecular formula C10H19F3O3S
and a molecular weight of 276.32 g/mol. Its IUPAC name is 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol.
Molecular Properties
| Compound Name | 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol |
| PubChem CID | 158241376 |
| Molecular Formula | C10H19F3O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol |
| SMILES | O=S(=O)(CCCCCCCO)CCC(F)(F)F |
| InChI | InChI=1S/C10H19F3O3S/c11-10(12,13)6-9-17(15,16)8-5-3-1-2-4-7-14/h14H,1-9H2 |
| InChIKey | GFOSESFNUCNTFT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol?
The IUPAC name of 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol (CID 158241376) is 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol.
What is the SMILES notation for 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol?
The canonical SMILES for 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol is O=S(=O)(CCCCCCCO)CCC(F)(F)F.
What is the InChIKey of 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol?
The InChIKey is GFOSESFNUCNTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3O3S/c11-10(12,13)6-9-17(15,16)8-5-3-1-2-4-7-14/h14H,1-9H2.
What are the key properties of 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol?
7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol has a molecular weight of 276.32 g/mol, XLogP of 2.30, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,3,3-trifluoropropylsulfonyl)heptan-1-ol is sourced from PubChem (CID 158241376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).