About [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane
[5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane (PubChem CID 158241686) has the molecular formula C20H52O5
and a molecular weight of 372.63 g/mol. Its IUPAC name is [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane.
Molecular Properties
| Compound Name | [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane |
| PubChem CID | 158241686 |
| Molecular Formula | C20H52O5 |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.38 |
| IUPAC Name | [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane |
| SMILES | C.C.C.C.C.C.C.CCC1CC(CC(O)CC(C)OC(C)=O)OCO1 |
| InChI | InChI=1S/C13H24O5.7CH4/c1-4-12-7-13(17-8-16-12)6-11(15)5-9(2)18-10(3)14;;;;;;;/h9,11-13,15H,4-8H2,1-3H3;7*1H4 |
| InChIKey | GFPPVDNGSIXOGA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane?
The IUPAC name of [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane (CID 158241686) is [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane.
What is the SMILES notation for [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane?
The canonical SMILES for [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane is C.C.C.C.C.C.C.CCC1CC(CC(O)CC(C)OC(C)=O)OCO1.
What is the InChIKey of [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane?
The InChIKey is GFPPVDNGSIXOGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O5.7CH4/c1-4-12-7-13(17-8-16-12)6-11(15)5-9(2)18-10(3)14;;;;;;;/h9,11-13,15H,4-8H2,1-3H3;7*1H4.
What are the key properties of [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane?
[5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane has a molecular weight of 372.63 g/mol, XLogP of 6.07, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate;methane is sourced from PubChem (CID 158241686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).