About 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate
5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate (PubChem CID 158243019) has the molecular formula C21H21F3O4
and a molecular weight of 394.39 g/mol. Its IUPAC name is 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate.
Molecular Properties
| Compound Name | 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate |
| PubChem CID | 158243019 |
| Molecular Formula | C21H21F3O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate |
| SMILES | CCOC(=O)C(CCC(=O)OCc1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H21F3O4/c1-2-27-20(26)17(16-10-6-7-11-18(16)21(22,23)24)12-13-19(25)28-14-15-8-4-3-5-9-15/h3-11,17H,2,12-14H2,1H3 |
| InChIKey | GFTYJXOARFJYEZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate?
The IUPAC name of 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate (CID 158243019) is 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate.
What is the SMILES notation for 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate?
The canonical SMILES for 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate is CCOC(=O)C(CCC(=O)OCc1ccccc1)c1ccccc1C(F)(F)F.
What is the InChIKey of 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate?
The InChIKey is GFTYJXOARFJYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3O4/c1-2-27-20(26)17(16-10-6-7-11-18(16)21(22,23)24)12-13-19(25)28-14-15-8-4-3-5-9-15/h3-11,17H,2,12-14H2,1H3.
What are the key properties of 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate?
5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate has a molecular weight of 394.39 g/mol, XLogP of 4.88, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-benzyl 1-O-ethyl 2-[2-(trifluoromethyl)phenyl]pentanedioate is sourced from PubChem (CID 158243019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).