C24H28ClN3O — CID 158243317
2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-7-carboxamide (PubChem CID 158243317) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-7-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-7-carboxamide |
|---|---|
| PubChem CID | 158243317 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-7-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCCCC1)C2 |
| InChI | InChI=1S/C24H28ClN3O/c1-28(2)22(29)18-9-10-19-15-24(11-4-3-5-12-24)23(27-21(19)14-18)26-16-17-7-6-8-20(25)13-17/h6-10,13-14H,3-5,11-12,15-16H2,1-2H3,(H,26,27) |
| InChIKey | GFUXVZPUOSRBCE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|