C32H31N3O3 — CID 158244854
1-[3-(2,4-dimethylfuran-3-yl)-5-[(S)-oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]-2-isocyanoethanol (PubChem CID 158244854) has the molecular formula C32H31N3O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylfuran-3-yl)-5-[(S)-oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]-2-isocyanoethanol.
| Compound Name | 1-[3-(2,4-dimethylfuran-3-yl)-5-[(S)-oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]-2-isocyanoethanol |
|---|---|
| PubChem CID | 158244854 |
| Molecular Formula | C32H31N3O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 1-[3-(2,4-dimethylfuran-3-yl)-5-[(S)-oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]-2-isocyanoethanol |
| SMILES | [C-]#[N+]CC(O)c1ccc2c3ncc(-c4c(C)coc4C)cc3n([C@H](c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C32H31N3O3/c1-20-19-38-21(2)30(20)25-16-28-31(34-17-25)26-10-9-24(29(36)18-33-3)15-27(26)35(28)32(22-7-5-4-6-8-22)23-11-13-37-14-12-23/h4-10,15-17,19,23,29,32,36H,11-14,18H2,1-2H3/t29?,32-/m1/s1 |
| InChIKey | RMSIGNNEHGOTPV-CUPMVOCTSA-N |
| XLogP | 7.04 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|