C10H10Br4F4O4 — CID 158245110
1,5-dibromo-3,3-difluoropentane-2,4-dione;3,3-difluoropentane-2,4-dione;molecular bromine (PubChem CID 158245110) has the molecular formula C10H10Br4F4O4 and a molecular weight of 589.79 g/mol. Its IUPAC name is 1,5-dibromo-3,3-difluoropentane-2,4-dione;3,3-difluoropentane-2,4-dione;molecular bromine.
| Compound Name | 1,5-dibromo-3,3-difluoropentane-2,4-dione;3,3-difluoropentane-2,4-dione;molecular bromine |
|---|---|
| PubChem CID | 158245110 |
| Molecular Formula | C10H10Br4F4O4 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 585.72 |
| IUPAC Name | 1,5-dibromo-3,3-difluoropentane-2,4-dione;3,3-difluoropentane-2,4-dione;molecular bromine |
| SMILES | BrBr.CC(=O)C(F)(F)C(C)=O.O=C(CBr)C(F)(F)C(=O)CBr |
| InChI | InChI=1S/C5H4Br2F2O2.C5H6F2O2.Br2/c6-1-3(10)5(8,9)4(11)2-7;1-3(8)5(6,7)4(2)9;1-2/h1-2H2;1-2H3; |
| InChIKey | GGADXTNKYCUOSQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|