C23H23ClF2O4 — CID 158246202
2-(4-chlorobenzoyl)-3-fluoro-5-[1-(1-fluorocyclohexyl)-1-hydroxypropyl]benzoic acid (PubChem CID 158246202) has the molecular formula C23H23ClF2O4 and a molecular weight of 436.88 g/mol. Its IUPAC name is 2-(4-chlorobenzoyl)-3-fluoro-5-[1-(1-fluorocyclohexyl)-1-hydroxypropyl]benzoic acid.
| Compound Name | 2-(4-chlorobenzoyl)-3-fluoro-5-[1-(1-fluorocyclohexyl)-1-hydroxypropyl]benzoic acid |
|---|---|
| PubChem CID | 158246202 |
| Molecular Formula | C23H23ClF2O4 |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-(4-chlorobenzoyl)-3-fluoro-5-[1-(1-fluorocyclohexyl)-1-hydroxypropyl]benzoic acid |
| SMILES | CCC(O)(c1cc(F)c(C(=O)c2ccc(Cl)cc2)c(C(=O)O)c1)C1(F)CCCCC1 |
| InChI | InChI=1S/C23H23ClF2O4/c1-2-23(30,22(26)10-4-3-5-11-22)15-12-17(21(28)29)19(18(25)13-15)20(27)14-6-8-16(24)9-7-14/h6-9,12-13,30H,2-5,10-11H2,1H3,(H,28,29) |
| InChIKey | KMKJNFFCGRQVAW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |