About dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide
dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide (PubChem CID 15824696) has the molecular formula C20H16Cl2Zr
and a molecular weight of 418.48 g/mol. Its IUPAC name is dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide.
Molecular Properties
| Compound Name | dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide |
| PubChem CID | 15824696 |
| Molecular Formula | C20H16Cl2Zr |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide |
| SMILES | Cl[Zr+2]Cl.c1ccc2c(c1)cc[c-]2CC[c-]1ccc2ccccc21 |
| InChI | InChI=1S/C20H16.2ClH.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h1-12H,13-14H2;2*1H;/q-2;;;+4/p-2 |
| InChIKey | TYGIJVHJINRQJV-UHFFFAOYSA-L |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide?
The IUPAC name of dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide (CID 15824696) is dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide.
What is the SMILES notation for dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide?
The canonical SMILES for dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide is Cl[Zr+2]Cl.c1ccc2c(c1)cc[c-]2CC[c-]1ccc2ccccc21.
What is the InChIKey of dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide?
The InChIKey is TYGIJVHJINRQJV-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H16.2ClH.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h1-12H,13-14H2;2*1H;/q-2;;;+4/p-2.
What are the key properties of dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide?
dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide has a molecular weight of 418.48 g/mol, XLogP of 6.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium(2+);1-(2-inden-1-id-1-ylethyl)inden-1-ide is sourced from PubChem (CID 15824696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).