C20H42N4 — CID 158248494
1,4-dimethyl-3,6-dihydro-2H-pyridine;1,4-dimethylpiperazine;1,4-dimethylpiperidine (PubChem CID 158248494) has the molecular formula C20H42N4 and a molecular weight of 338.58 g/mol. Its IUPAC name is 1,4-dimethyl-3,6-dihydro-2H-pyridine;1,4-dimethylpiperazine;1,4-dimethylpiperidine.
| Compound Name | 1,4-dimethyl-3,6-dihydro-2H-pyridine;1,4-dimethylpiperazine;1,4-dimethylpiperidine |
|---|---|
| PubChem CID | 158248494 |
| Molecular Formula | C20H42N4 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.34 |
| IUPAC Name | 1,4-dimethyl-3,6-dihydro-2H-pyridine;1,4-dimethylpiperazine;1,4-dimethylpiperidine |
| SMILES | CC1=CCN(C)CC1.CC1CCN(C)CC1.CN1CCN(C)CC1 |
| InChI | InChI=1S/C7H15N.C7H13N.C6H14N2/c3*1-7-3-5-8(2)6-4-7/h7H,3-6H2,1-2H3;3H,4-6H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | GGKPHCMBBWEISP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|