C25H29F2N3O3 — CID 158249528
(3S,7S)-4-cyclobutyl-13-[3-(2,4-difluorophenyl)propyl]-11-hydroxy-7-methyl-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 158249528) has the molecular formula C25H29F2N3O3 and a molecular weight of 457.52 g/mol. Its IUPAC name is (3S,7S)-4-cyclobutyl-13-[3-(2,4-difluorophenyl)propyl]-11-hydroxy-7-methyl-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3S,7S)-4-cyclobutyl-13-[3-(2,4-difluorophenyl)propyl]-11-hydroxy-7-methyl-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 158249528 |
| Molecular Formula | C25H29F2N3O3 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (3S,7S)-4-cyclobutyl-13-[3-(2,4-difluorophenyl)propyl]-11-hydroxy-7-methyl-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | C[C@H]1CCN(C2CCC2)[C@@H]2Cn3cc(CCCc4ccc(F)cc4F)c(=O)c(O)c3C(=O)N12 |
| InChI | InChI=1S/C25H29F2N3O3/c1-15-10-11-29(19-6-3-7-19)21-14-28-13-17(23(31)24(32)22(28)25(33)30(15)21)5-2-4-16-8-9-18(26)12-20(16)27/h8-9,12-13,15,19,21,32H,2-7,10-11,14H2,1H3/t15-,21-/m0/s1 |
| InChIKey | GGNSGHXRFTWDOF-BTYIYWSLSA-N |
| XLogP | 3.44 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |