About 1-phenylpropane-1,2-diol
1-phenylpropane-1,2-diol (PubChem CID 15825) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-phenylpropane-1,2-diol.
Molecular Properties
| Compound Name | 1-phenylpropane-1,2-diol |
| PubChem CID | 15825 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-phenylpropane-1,2-diol |
| SMILES | CC(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C9H12O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9-11H,1H3 |
| InChIKey | MZQZXSHFWDHNOW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropane-1,2-diol?
The IUPAC name of 1-phenylpropane-1,2-diol (CID 15825) is 1-phenylpropane-1,2-diol.
What is the SMILES notation for 1-phenylpropane-1,2-diol?
The canonical SMILES for 1-phenylpropane-1,2-diol is CC(O)C(O)c1ccccc1.
What is the InChIKey of 1-phenylpropane-1,2-diol?
The InChIKey is MZQZXSHFWDHNOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9-11H,1H3.
What are the key properties of 1-phenylpropane-1,2-diol?
1-phenylpropane-1,2-diol has a molecular weight of 152.19 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropane-1,2-diol is sourced from PubChem (CID 15825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).