C24H28NO7S+ — CID 158250468
cis-(1S,2R)-cyclohexane-1,2-dicarboxylic acid;spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidin-1-ium]-5,6-dione (PubChem CID 158250468) has the molecular formula C24H28NO7S+ and a molecular weight of 474.56 g/mol. Its IUPAC name is cis-(1S,2R)-cyclohexane-1,2-dicarboxylic acid;spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidin-1-ium]-5,6-dione.
| Compound Name | cis-(1S,2R)-cyclohexane-1,2-dicarboxylic acid;spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidin-1-ium]-5,6-dione |
|---|---|
| PubChem CID | 158250468 |
| Molecular Formula | C24H28NO7S+ |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | cis-(1S,2R)-cyclohexane-1,2-dicarboxylic acid;spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidin-1-ium]-5,6-dione |
| SMILES | O=C(O)[C@H]1CCCC[C@H]1C(=O)O.O=C1C(=O)c2ccccc2C2=C1SCC1(CC[NH2+]CC1)O2 |
| InChI | InChI=1S/C16H15NO3S.C8H12O4/c18-12-10-3-1-2-4-11(10)14-15(13(12)19)21-9-16(20-14)5-7-17-8-6-16;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,17H,5-9H2;5-6H,1-4H2,(H,9,10)(H,11,12)/p+1/t;5-,6+ |
| InChIKey | GGQNIUSARAXLTK-WNTRXTAUSA-O |
| XLogP | 1.94 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|